C32H43ClN2O2 — CID 155697038
ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclohexane-1-carboxylate (PubChem CID 155697038) has the molecular formula C32H43ClN2O2 and a molecular weight of 523.16 g/mol. Its IUPAC name is ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155697038 |
| Molecular Formula | C32H43ClN2O2 |
| Molecular Weight | 523.16 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | ethyl 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCCCC1Nc1ccc(Nc2ccc(C3(C)CC4CC(C)CC(C4)C3)cc2Cl)cc1 |
| InChI | InChI=1S/C32H43ClN2O2/c1-4-37-31(36)27-7-5-6-8-29(27)34-25-10-12-26(13-11-25)35-30-14-9-24(18-28(30)33)32(3)19-22-15-21(2)16-23(17-22)20-32/h9-14,18,21-23,27,29,34-35H,4-8,15-17,19-20H2,1-3H3 |
| InChIKey | SANFEVHVJGRQOE-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.16 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|