C29H36ClN3O2 — CID 155697323
N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]-2-formylpyrrolidine-1-carboxamide (PubChem CID 155697323) has the molecular formula C29H36ClN3O2 and a molecular weight of 494.08 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]-2-formylpyrrolidine-1-carboxamide.
| Compound Name | N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]-2-formylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 155697323 |
| Molecular Formula | C29H36ClN3O2 |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]-2-formylpyrrolidine-1-carboxamide |
| SMILES | CC1CC2CC(C)CC(c3ccc(Nc4ccc(NC(=O)N5CCCC5C=O)cc4)c(Cl)c3)(C1)C2 |
| InChI | InChI=1S/C29H36ClN3O2/c1-19-12-21-13-20(2)16-29(15-19,17-21)22-5-10-27(26(30)14-22)31-23-6-8-24(9-7-23)32-28(35)33-11-3-4-25(33)18-34/h5-10,14,18-21,25,31H,3-4,11-13,15-17H2,1-2H3,(H,32,35) |
| InChIKey | OUVSNSRDAUNDOA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|