C20H32ClIN5OPS — CID 155698023
4-chloro-5-[4-[1-(2-ethyl-3-pyridinyl)ethyl]piperazin-1-yl]-2-iodophosphanylpyridazin-3-one;ethane;methanethiol (PubChem CID 155698023) has the molecular formula C20H32ClIN5OPS and a molecular weight of 583.91 g/mol. Its IUPAC name is 4-chloro-5-[4-[1-(2-ethyl-3-pyridinyl)ethyl]piperazin-1-yl]-2-iodophosphanylpyridazin-3-one;ethane;methanethiol.
| Compound Name | 4-chloro-5-[4-[1-(2-ethyl-3-pyridinyl)ethyl]piperazin-1-yl]-2-iodophosphanylpyridazin-3-one;ethane;methanethiol |
|---|---|
| PubChem CID | 155698023 |
| Molecular Formula | C20H32ClIN5OPS |
| Molecular Weight | 583.91 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | 4-chloro-5-[4-[1-(2-ethyl-3-pyridinyl)ethyl]piperazin-1-yl]-2-iodophosphanylpyridazin-3-one;ethane;methanethiol |
| SMILES | CC.CCc1ncccc1C(C)N1CCN(c2cnn(PI)c(=O)c2Cl)CC1.CS |
| InChI | InChI=1S/C17H22ClIN5OP.C2H6.CH4S/c1-3-14-13(5-4-6-20-14)12(2)22-7-9-23(10-8-22)15-11-21-24(26-19)17(25)16(15)18;2*1-2/h4-6,11-12,26H,3,7-10H2,1-2H3;1-2H3;2H,1H3 |
| InChIKey | FZWFFIGFMCZREF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|