C18H23ClF3IN5O2P — CID 142547117
4-chloro-2-iodophosphanyl-5-[4-[[6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]piperazin-1-yl]pyridazin-3-one;ethane (PubChem CID 142547117) has the molecular formula C18H23ClF3IN5O2P and a molecular weight of 591.74 g/mol. Its IUPAC name is 4-chloro-2-iodophosphanyl-5-[4-[[6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]piperazin-1-yl]pyridazin-3-one;ethane.
| Compound Name | 4-chloro-2-iodophosphanyl-5-[4-[[6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]piperazin-1-yl]pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 142547117 |
| Molecular Formula | C18H23ClF3IN5O2P |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.03 |
| IUPAC Name | 4-chloro-2-iodophosphanyl-5-[4-[[6-oxo-1-(2,2,2-trifluoroethyl)-2-pyridinyl]methyl]piperazin-1-yl]pyridazin-3-one;ethane |
| SMILES | CC.O=c1c(Cl)c(N2CCN(Cc3cccc(=O)n3CC(F)(F)F)CC2)cnn1PI |
| InChI | InChI=1S/C16H17ClF3IN5O2P.C2H6/c17-14-12(8-22-26(29-21)15(14)28)24-6-4-23(5-7-24)9-11-2-1-3-13(27)25(11)10-16(18,19)20;1-2/h1-3,8,29H,4-7,9-10H2;1-2H3 |
| InChIKey | DTNOJBOGRBWXQH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|