C22H22ClFN4O — CID 19245547
5-(4-benzylpiperazin-1-yl)-4-chloro-2-[(4-fluorophenyl)methyl]pyridazin-3-one (PubChem CID 19245547) has the molecular formula C22H22ClFN4O and a molecular weight of 412.90 g/mol. Its IUPAC name is 5-(4-benzylpiperazin-1-yl)-4-chloro-2-[(4-fluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(4-benzylpiperazin-1-yl)-4-chloro-2-[(4-fluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 19245547 |
| Molecular Formula | C22H22ClFN4O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-(4-benzylpiperazin-1-yl)-4-chloro-2-[(4-fluorophenyl)methyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(Cc3ccccc3)CC2)cnn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22ClFN4O/c23-21-20(14-25-28(22(21)29)16-18-6-8-19(24)9-7-18)27-12-10-26(11-13-27)15-17-4-2-1-3-5-17/h1-9,14H,10-13,15-16H2 |
| InChIKey | JDXNDNNKKBKLOZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |