C21H19Cl2FN4O — CID 19245533
4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 19245533) has the molecular formula C21H19Cl2FN4O and a molecular weight of 433.31 g/mol. Its IUPAC name is 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 19245533 |
| Molecular Formula | C21H19Cl2FN4O |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(2-fluorophenyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(c3ccccc3F)CC2)cnn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2FN4O/c22-16-7-5-15(6-8-16)14-28-21(29)20(23)19(13-25-28)27-11-9-26(10-12-27)18-4-2-1-3-17(18)24/h1-8,13H,9-12,14H2 |
| InChIKey | WLIOXSXXBDHUBU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |