C21H19Cl3N4O — CID 19245531
4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 19245531) has the molecular formula C21H19Cl3N4O and a molecular weight of 449.77 g/mol. Its IUPAC name is 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 19245531 |
| Molecular Formula | C21H19Cl3N4O |
| Molecular Weight | 449.77 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 4-chloro-2-[(4-chlorophenyl)methyl]-5-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(N2CCN(c3cccc(Cl)c3)CC2)cnn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl3N4O/c22-16-6-4-15(5-7-16)14-28-21(29)20(24)19(13-25-28)27-10-8-26(9-11-27)18-3-1-2-17(23)12-18/h1-7,12-13H,8-11,14H2 |
| InChIKey | LEZGBCJINFLNPE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.77 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |