C15H18CoNO- — CID 155698186
1-[(4S)-4-ethyl-1,3,4,7-tetrahydroisoquinolin-7-id-2-yl]prop-2-en-1-one;methylidenecobalt (PubChem CID 155698186) has the molecular formula C15H18CoNO- and a molecular weight of 287.25 g/mol. Its IUPAC name is 1-[(4S)-4-ethyl-1,3,4,7-tetrahydroisoquinolin-7-id-2-yl]prop-2-en-1-one;methylidenecobalt.
| Compound Name | 1-[(4S)-4-ethyl-1,3,4,7-tetrahydroisoquinolin-7-id-2-yl]prop-2-en-1-one;methylidenecobalt |
|---|---|
| PubChem CID | 155698186 |
| Molecular Formula | C15H18CoNO- |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-[(4S)-4-ethyl-1,3,4,7-tetrahydroisoquinolin-7-id-2-yl]prop-2-en-1-one;methylidenecobalt |
| SMILES | C=CC(=O)N1Cc2c[c-]ccc2[C@H](CC)C1.C=[Co] |
| InChI | InChI=1S/C14H16NO.CH2.Co/c1-3-11-9-15(14(16)4-2)10-12-7-5-6-8-13(11)12;;/h4,6-8,11H,2-3,9-10H2,1H3;1H2;/q-1;;/t11-;;/m1../s1 |
| InChIKey | FCSBRSSSVKSSRS-NVJADKKVSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|