C10H13NO4 — CID 15569863
methyl N-(2-oxo-3a,4,5,7a-tetrahydro-3H-1-benzofuran-3-yl)carbamate (PubChem CID 15569863) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl N-(2-oxo-3a,4,5,7a-tetrahydro-3H-1-benzofuran-3-yl)carbamate.
| Compound Name | methyl N-(2-oxo-3a,4,5,7a-tetrahydro-3H-1-benzofuran-3-yl)carbamate |
|---|---|
| PubChem CID | 15569863 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl N-(2-oxo-3a,4,5,7a-tetrahydro-3H-1-benzofuran-3-yl)carbamate |
| SMILES | COC(=O)NC1C(=O)OC2C=CCCC21 |
| InChI | InChI=1S/C10H13NO4/c1-14-10(13)11-8-6-4-2-3-5-7(6)15-9(8)12/h3,5-8H,2,4H2,1H3,(H,11,13) |
| InChIKey | HENWUASESAETGZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|