C10H16N2O4 — CID 10105166
methyl N-[1-cyclopent-2-en-1-yl-2-(methoxyamino)-2-oxoethyl]carbamate (PubChem CID 10105166) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is methyl N-[1-cyclopent-2-en-1-yl-2-(methoxyamino)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[1-cyclopent-2-en-1-yl-2-(methoxyamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10105166 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | methyl N-[1-cyclopent-2-en-1-yl-2-(methoxyamino)-2-oxoethyl]carbamate |
| SMILES | CONC(=O)C(NC(=O)OC)C1C=CCC1 |
| InChI | InChI=1S/C10H16N2O4/c1-15-10(14)11-8(9(13)12-16-2)7-5-3-4-6-7/h3,5,7-8H,4,6H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | UMUPSUDMOYGJKI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|