C12H22N4O — CID 155698940
4-[tert-butyl(methyl)amino]-5-(methylideneamino)-1H-pyrimidin-6-one;ethane (PubChem CID 155698940) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-[tert-butyl(methyl)amino]-5-(methylideneamino)-1H-pyrimidin-6-one;ethane.
| Compound Name | 4-[tert-butyl(methyl)amino]-5-(methylideneamino)-1H-pyrimidin-6-one;ethane |
|---|---|
| PubChem CID | 155698940 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4-[tert-butyl(methyl)amino]-5-(methylideneamino)-1H-pyrimidin-6-one;ethane |
| SMILES | C=Nc1c(N(C)C(C)(C)C)nc[nH]c1=O.CC |
| InChI | InChI=1S/C10H16N4O.C2H6/c1-10(2,3)14(5)8-7(11-4)9(15)13-6-12-8;1-2/h6H,4H2,1-3,5H3,(H,12,13,15);1-2H3 |
| InChIKey | FENJYEPACKUCAP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|