C31H22N4O — CID 155699328
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylisoquinolin-1-one (PubChem CID 155699328) has the molecular formula C31H22N4O and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylisoquinolin-1-one.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 155699328 |
| Molecular Formula | C31H22N4O |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylisoquinolin-1-one |
| SMILES | Cc1cc2ccccc2c(=O)n1-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C31H22N4O/c1-21-19-24-15-8-9-18-27(24)31(36)35(21)26-17-10-16-25(20-26)30-33-28(22-11-4-2-5-12-22)32-29(34-30)23-13-6-3-7-14-23/h2-20H,1H3 |
| InChIKey | NMRTZJXYRXBRFC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |