C35H23N5O — CID 121247655
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylquinazolin-4-one (PubChem CID 121247655) has the molecular formula C35H23N5O and a molecular weight of 529.60 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylquinazolin-4-one.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 121247655 |
| Molecular Formula | C35H23N5O |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1-c1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C35H23N5O/c41-35-29-21-10-11-22-30(29)36-34(26-17-8-3-9-18-26)40(35)28-20-12-19-27(23-28)33-38-31(24-13-4-1-5-14-24)37-32(39-33)25-15-6-2-7-16-25/h1-23H |
| InChIKey | ZULXXSIEPAYQED-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |