C21H16N2O2 — CID 717898
3-(3-hydroxyphenyl)-2-(4-methylphenyl)quinazolin-4-one (PubChem CID 717898) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-2-(4-methylphenyl)quinazolin-4-one.
| Compound Name | 3-(3-hydroxyphenyl)-2-(4-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 717898 |
| Molecular Formula | C21H16N2O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-(3-hydroxyphenyl)-2-(4-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccc(-c2nc3ccccc3c(=O)n2-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C21H16N2O2/c1-14-9-11-15(12-10-14)20-22-19-8-3-2-7-18(19)21(25)23(20)16-5-4-6-17(24)13-16/h2-13,24H,1H3 |
| InChIKey | KVZOXOQWBADCRN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |