C58H36N10O2 — CID 163709957
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-oxoquinazolin-3-yl]phenyl]-2-phenylquinazolin-4-one (PubChem CID 163709957) has the molecular formula C58H36N10O2 and a molecular weight of 904.99 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-oxoquinazolin-3-yl]phenyl]-2-phenylquinazolin-4-one.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-oxoquinazolin-3-yl]phenyl]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 163709957 |
| Molecular Formula | C58H36N10O2 |
| Molecular Weight | 904.99 g/mol |
| Exact Mass | 904.30 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-oxoquinazolin-3-yl]phenyl]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)n1-c1cccc(-c2cccc3c(=O)n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c(-c4ccccc4)nc23)c1 |
| InChI | InChI=1S/C58H36N10O2/c69-56-45-32-16-17-35-47(45)59-55(53-63-49(37-20-6-1-7-21-37)61-50(64-53)38-22-8-2-9-23-38)67(56)43-31-18-30-42(36-43)44-33-19-34-46-48(44)60-54(41-28-14-5-15-29-41)68(57(46)70)58-65-51(39-24-10-3-11-25-39)62-52(66-58)40-26-12-4-13-27-40/h1-36H |
| InChIKey | KIIOJSAKMSPEBR-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 147.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.99 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |