C19H32FN3O2 — CID 155699977
N-[(3-fluorocyclohexyl)methyl]-5-(1-methyl-6-oxopiperidin-3-yl)piperidine-2-carboxamide (PubChem CID 155699977) has the molecular formula C19H32FN3O2 and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[(3-fluorocyclohexyl)methyl]-5-(1-methyl-6-oxopiperidin-3-yl)piperidine-2-carboxamide.
| Compound Name | N-[(3-fluorocyclohexyl)methyl]-5-(1-methyl-6-oxopiperidin-3-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 155699977 |
| Molecular Formula | C19H32FN3O2 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | N-[(3-fluorocyclohexyl)methyl]-5-(1-methyl-6-oxopiperidin-3-yl)piperidine-2-carboxamide |
| SMILES | CN1CC(C2CCC(C(=O)NCC3CCCC(F)C3)NC2)CCC1=O |
| InChI | InChI=1S/C19H32FN3O2/c1-23-12-15(6-8-18(23)24)14-5-7-17(21-11-14)19(25)22-10-13-3-2-4-16(20)9-13/h13-17,21H,2-12H2,1H3,(H,22,25) |
| InChIKey | WZMVAEIZKPGAQD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |