C28H36N6O3 — CID 155700608
6-(3-hydroxypyrrolidine-1-carbonyl)-N-[(3Z,5E)-6-methyl-7-(2-methylidenepyrrolidin-1-yl)-7-methyliminohepta-1,3,5-trien-2-yl]-7,8-dihydro-5H-2,6-naphthyridine-3-carboxamide (PubChem CID 155700608) has the molecular formula C28H36N6O3 and a molecular weight of 504.64 g/mol. Its IUPAC name is 6-(3-hydroxypyrrolidine-1-carbonyl)-N-[(3Z,5E)-6-methyl-7-(2-methylidenepyrrolidin-1-yl)-7-methyliminohepta-1,3,5-trien-2-yl]-7,8-dihydro-5H-2,6-naphthyridine-3-carboxamide.
| Compound Name | 6-(3-hydroxypyrrolidine-1-carbonyl)-N-[(3Z,5E)-6-methyl-7-(2-methylidenepyrrolidin-1-yl)-7-methyliminohepta-1,3,5-trien-2-yl]-7,8-dihydro-5H-2,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 155700608 |
| Molecular Formula | C28H36N6O3 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 6-(3-hydroxypyrrolidine-1-carbonyl)-N-[(3Z,5E)-6-methyl-7-(2-methylidenepyrrolidin-1-yl)-7-methyliminohepta-1,3,5-trien-2-yl]-7,8-dihydro-5H-2,6-naphthyridine-3-carboxamide |
| SMILES | C=C(/C=C\C=C(C)\C(=N\C)N1CCCC1=C)NC(=O)c1cc2c(cn1)CCN(C(=O)N1CCC(O)C1)C2 |
| InChI | InChI=1S/C28H36N6O3/c1-19(26(29-4)34-12-6-9-21(34)3)7-5-8-20(2)31-27(36)25-15-23-17-32(13-10-22(23)16-30-25)28(37)33-14-11-24(35)18-33/h5,7-8,15-16,24,35H,2-3,6,9-14,17-18H2,1,4H3,(H,31,36)/b8-5-,19-7+,29-26- |
| InChIKey | BLHCNMLPWBRKQO-UBOYTJAJSA-N |
| XLogP | 3.01 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|