C19H27N3O — CID 155701454
(2R)-1-(4-methoxyphenyl)-N-[2-[6-(methylaminomethyl)-2-pyridinyl]ethyl]propan-2-amine (PubChem CID 155701454) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (2R)-1-(4-methoxyphenyl)-N-[2-[6-(methylaminomethyl)-2-pyridinyl]ethyl]propan-2-amine.
| Compound Name | (2R)-1-(4-methoxyphenyl)-N-[2-[6-(methylaminomethyl)-2-pyridinyl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 155701454 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (2R)-1-(4-methoxyphenyl)-N-[2-[6-(methylaminomethyl)-2-pyridinyl]ethyl]propan-2-amine |
| SMILES | CNCc1cccc(CCN[C@H](C)Cc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C19H27N3O/c1-15(13-16-7-9-19(23-3)10-8-16)21-12-11-17-5-4-6-18(22-17)14-20-2/h4-10,15,20-21H,11-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | HACMAWBSIVDIGI-OAHLLOKOSA-N |
| XLogP | 2.57 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |