C9H18F3NO3S — CID 155701897
ethane;N-(4,4,4-trifluoro-3-methylsulfonylbutyl)acetamide (PubChem CID 155701897) has the molecular formula C9H18F3NO3S and a molecular weight of 277.31 g/mol. Its IUPAC name is ethane;N-(4,4,4-trifluoro-3-methylsulfonylbutyl)acetamide.
| Compound Name | ethane;N-(4,4,4-trifluoro-3-methylsulfonylbutyl)acetamide |
|---|---|
| PubChem CID | 155701897 |
| Molecular Formula | C9H18F3NO3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | ethane;N-(4,4,4-trifluoro-3-methylsulfonylbutyl)acetamide |
| SMILES | CC.CC(=O)NCCC(C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C7H12F3NO3S.C2H6/c1-5(12)11-4-3-6(7(8,9)10)15(2,13)14;1-2/h6H,3-4H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | MIENZISUUSWGBS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |