C21H30O15 — CID 155701938
[5,8-di(butanoyloxy)-2,5,8-tris(hydroxymethyl)-3,6,9-trioxo-1,4,7-trioxonan-2-yl] butanoate (PubChem CID 155701938) has the molecular formula C21H30O15 and a molecular weight of 522.46 g/mol. Its IUPAC name is [5,8-di(butanoyloxy)-2,5,8-tris(hydroxymethyl)-3,6,9-trioxo-1,4,7-trioxonan-2-yl] butanoate.
| Compound Name | [5,8-di(butanoyloxy)-2,5,8-tris(hydroxymethyl)-3,6,9-trioxo-1,4,7-trioxonan-2-yl] butanoate |
|---|---|
| PubChem CID | 155701938 |
| Molecular Formula | C21H30O15 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [5,8-di(butanoyloxy)-2,5,8-tris(hydroxymethyl)-3,6,9-trioxo-1,4,7-trioxonan-2-yl] butanoate |
| SMILES | CCCC(=O)OC1(CO)OC(=O)C(CO)(OC(=O)CCC)OC(=O)C(CO)(OC(=O)CCC)OC1=O |
| InChI | InChI=1S/C21H30O15/c1-4-7-13(25)31-19(10-22)16(28)35-21(12-24,33-15(27)9-6-3)18(30)36-20(11-23,17(29)34-19)32-14(26)8-5-2/h22-24H,4-12H2,1-3H3 |
| InChIKey | IXIXHSBDFXICBH-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|