C21H24N4O3 — CID 155703043
tert-butyl 3-[2-(4-cyanophenyl)propanoylamino]-5-cyclopropylpyrazole-1-carboxylate (PubChem CID 155703043) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-cyanophenyl)propanoylamino]-5-cyclopropylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-cyanophenyl)propanoylamino]-5-cyclopropylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 155703043 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | tert-butyl 3-[2-(4-cyanophenyl)propanoylamino]-5-cyclopropylpyrazole-1-carboxylate |
| SMILES | CC(C(=O)Nc1cc(C2CC2)n(C(=O)OC(C)(C)C)n1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-13(15-7-5-14(12-22)6-8-15)19(26)23-18-11-17(16-9-10-16)25(24-18)20(27)28-21(2,3)4/h5-8,11,13,16H,9-10H2,1-4H3,(H,23,24,26) |
| InChIKey | MIWIZSSKLSJRNV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |