C21H39N3O3S2 — CID 155704770
5-[[(Z)-1-butylsulfanylpent-1-enyl]amino]-1,3,4-trimethyl-6-sulfanylidenepyrimidin-2-one;ethane;ethyl formate (PubChem CID 155704770) has the molecular formula C21H39N3O3S2 and a molecular weight of 445.70 g/mol. Its IUPAC name is 5-[[(Z)-1-butylsulfanylpent-1-enyl]amino]-1,3,4-trimethyl-6-sulfanylidenepyrimidin-2-one;ethane;ethyl formate.
| Compound Name | 5-[[(Z)-1-butylsulfanylpent-1-enyl]amino]-1,3,4-trimethyl-6-sulfanylidenepyrimidin-2-one;ethane;ethyl formate |
|---|---|
| PubChem CID | 155704770 |
| Molecular Formula | C21H39N3O3S2 |
| Molecular Weight | 445.70 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 5-[[(Z)-1-butylsulfanylpent-1-enyl]amino]-1,3,4-trimethyl-6-sulfanylidenepyrimidin-2-one;ethane;ethyl formate |
| SMILES | CC.CCC/C=C(/Nc1c(C)n(C)c(=O)n(C)c1=S)SCCCC.CCOC=O |
| InChI | InChI=1S/C16H27N3OS2.C3H6O2.C2H6/c1-6-8-10-13(22-11-9-7-2)17-14-12(3)18(4)16(20)19(5)15(14)21;1-2-5-3-4;1-2/h10,17H,6-9,11H2,1-5H3;3H,2H2,1H3;1-2H3/b13-10-;; |
| InChIKey | UDPFNJGPCAJYKL-CAPVWHLOSA-N |
| XLogP | 5.55 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|