C20H35N3 — CID 155707430
N-[[4-[[4-(2-methylbutyl)piperazin-1-yl]methyl]phenyl]methyl]propan-2-amine (PubChem CID 155707430) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[[4-[[4-(2-methylbutyl)piperazin-1-yl]methyl]phenyl]methyl]propan-2-amine.
| Compound Name | N-[[4-[[4-(2-methylbutyl)piperazin-1-yl]methyl]phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 155707430 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | N-[[4-[[4-(2-methylbutyl)piperazin-1-yl]methyl]phenyl]methyl]propan-2-amine |
| SMILES | CCC(C)CN1CCN(Cc2ccc(CNC(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H35N3/c1-5-18(4)15-22-10-12-23(13-11-22)16-20-8-6-19(7-9-20)14-21-17(2)3/h6-9,17-18,21H,5,10-16H2,1-4H3 |
| InChIKey | HQAPTJGKPBQMDE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |