C18H30N2 — CID 167264369
1-(2-methylpropyl)-4-[(4-propylphenyl)methyl]piperazine (PubChem CID 167264369) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(2-methylpropyl)-4-[(4-propylphenyl)methyl]piperazine.
| Compound Name | 1-(2-methylpropyl)-4-[(4-propylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 167264369 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(2-methylpropyl)-4-[(4-propylphenyl)methyl]piperazine |
| SMILES | CCCc1ccc(CN2CCN(CC(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H30N2/c1-4-5-17-6-8-18(9-7-17)15-20-12-10-19(11-13-20)14-16(2)3/h6-9,16H,4-5,10-15H2,1-3H3 |
| InChIKey | WFWGVVMHIJAMJE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |