C18H35N3 — CID 156794443
ethane;[4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]methanamine;molecular hydrogen (PubChem CID 156794443) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is ethane;[4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]methanamine;molecular hydrogen.
| Compound Name | ethane;[4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]methanamine;molecular hydrogen |
|---|---|
| PubChem CID | 156794443 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | ethane;[4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]methanamine;molecular hydrogen |
| SMILES | CC.CC(C)CN1CCN(Cc2ccc(CN)cc2)CC1.[H][H] |
| InChI | InChI=1S/C16H27N3.C2H6.H2/c1-14(2)12-18-7-9-19(10-8-18)13-16-5-3-15(11-17)4-6-16;1-2;/h3-6,14H,7-13,17H2,1-2H3;1-2H3;1H |
| InChIKey | STNQSPAONYKZAF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |