C23H33N3 — CID 174866108
[3-[3-methyl-4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]phenyl]methanamine (PubChem CID 174866108) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is [3-[3-methyl-4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]phenyl]methanamine.
| Compound Name | [3-[3-methyl-4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 174866108 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | [3-[3-methyl-4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]phenyl]phenyl]methanamine |
| SMILES | Cc1cc(-c2cccc(CN)c2)ccc1CN1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C23H33N3/c1-18(2)16-25-9-11-26(12-10-25)17-23-8-7-22(13-19(23)3)21-6-4-5-20(14-21)15-24/h4-8,13-14,18H,9-12,15-17,24H2,1-3H3 |
| InChIKey | JTJUYFOYBVRWIG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |