C8H14N2O — CID 155707564
6-methyl-3-propan-2-yl-1,6-dihydropyrimidin-2-one (PubChem CID 155707564) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-methyl-3-propan-2-yl-1,6-dihydropyrimidin-2-one.
| Compound Name | 6-methyl-3-propan-2-yl-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 155707564 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 6-methyl-3-propan-2-yl-1,6-dihydropyrimidin-2-one |
| SMILES | CC1C=CN(C(C)C)C(=O)N1 |
| InChI | InChI=1S/C8H14N2O/c1-6(2)10-5-4-7(3)9-8(10)11/h4-7H,1-3H3,(H,9,11) |
| InChIKey | CZUWVWRYIUOAAA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |