C21H30N4O2 — CID 155707669
N-benzhydryl-2-(2-methylhydrazinyl)pentanediamide;ethane (PubChem CID 155707669) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-benzhydryl-2-(2-methylhydrazinyl)pentanediamide;ethane.
| Compound Name | N-benzhydryl-2-(2-methylhydrazinyl)pentanediamide;ethane |
|---|---|
| PubChem CID | 155707669 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-benzhydryl-2-(2-methylhydrazinyl)pentanediamide;ethane |
| SMILES | CC.CNNC(CCC(N)=O)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N4O2.C2H6/c1-21-23-16(12-13-17(20)24)19(25)22-18(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-2/h2-11,16,18,21,23H,12-13H2,1H3,(H2,20,24)(H,22,25);1-2H3 |
| InChIKey | FBSHRIGOYILPIW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|