C21H31BrClN7O2 — CID 155708262
1-[5-bromo-4-(1-methoxyethyl)-3-pyridinyl]-3-[5-chloro-6-[[(Z)-ethylideneamino]-(methylideneamino)amino]-3-pyridinyl]urea;ethane (PubChem CID 155708262) has the molecular formula C21H31BrClN7O2 and a molecular weight of 528.88 g/mol. Its IUPAC name is 1-[5-bromo-4-(1-methoxyethyl)-3-pyridinyl]-3-[5-chloro-6-[[(Z)-ethylideneamino]-(methylideneamino)amino]-3-pyridinyl]urea;ethane.
| Compound Name | 1-[5-bromo-4-(1-methoxyethyl)-3-pyridinyl]-3-[5-chloro-6-[[(Z)-ethylideneamino]-(methylideneamino)amino]-3-pyridinyl]urea;ethane |
|---|---|
| PubChem CID | 155708262 |
| Molecular Formula | C21H31BrClN7O2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 1-[5-bromo-4-(1-methoxyethyl)-3-pyridinyl]-3-[5-chloro-6-[[(Z)-ethylideneamino]-(methylideneamino)amino]-3-pyridinyl]urea;ethane |
| SMILES | C=NN(/N=C\C)c1ncc(NC(=O)Nc2cncc(Br)c2C(C)OC)cc1Cl.CC.CC |
| InChI | InChI=1S/C17H19BrClN7O2.2C2H6/c1-5-23-26(20-3)16-13(19)6-11(7-22-16)24-17(27)25-14-9-21-8-12(18)15(14)10(2)28-4;2*1-2/h5-10H,3H2,1-2,4H3,(H2,24,25,27);2*1-2H3/b23-5-;; |
| InChIKey | ZNKKHEMAQGIILS-VXDZRJKQSA-N |
| XLogP | 6.72 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|