C22H24ClN7O2 — CID 142425520
1-[5-chloro-6-[[(Z)-ethylideneamino]-(methylamino)amino]-3-pyridinyl]-3-(4-cyclopropyl-6-methoxyquinolin-3-yl)urea (PubChem CID 142425520) has the molecular formula C22H24ClN7O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 1-[5-chloro-6-[[(Z)-ethylideneamino]-(methylamino)amino]-3-pyridinyl]-3-(4-cyclopropyl-6-methoxyquinolin-3-yl)urea.
| Compound Name | 1-[5-chloro-6-[[(Z)-ethylideneamino]-(methylamino)amino]-3-pyridinyl]-3-(4-cyclopropyl-6-methoxyquinolin-3-yl)urea |
|---|---|
| PubChem CID | 142425520 |
| Molecular Formula | C22H24ClN7O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-[5-chloro-6-[[(Z)-ethylideneamino]-(methylamino)amino]-3-pyridinyl]-3-(4-cyclopropyl-6-methoxyquinolin-3-yl)urea |
| SMILES | C/C=N\N(NC)c1ncc(NC(=O)Nc2cnc3ccc(OC)cc3c2C2CC2)cc1Cl |
| InChI | InChI=1S/C22H24ClN7O2/c1-4-27-30(24-2)21-17(23)9-14(11-26-21)28-22(31)29-19-12-25-18-8-7-15(32-3)10-16(18)20(19)13-5-6-13/h4,7-13,24H,5-6H2,1-3H3,(H2,28,29,31)/b27-4- |
| InChIKey | BYFHICXIWRVNQR-MEOYLPNLSA-N |
| XLogP | 4.76 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|