C37H22BrN5 — CID 155708623
4-[4-[6-(3-bromo-5-quinolin-5-ylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]phenyl]benzonitrile (PubChem CID 155708623) has the molecular formula C37H22BrN5 and a molecular weight of 616.52 g/mol. Its IUPAC name is 4-[4-[6-(3-bromo-5-quinolin-5-ylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[6-(3-bromo-5-quinolin-5-ylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155708623 |
| Molecular Formula | C37H22BrN5 |
| Molecular Weight | 616.52 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | 4-[4-[6-(3-bromo-5-quinolin-5-ylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3cc(-c4cc(Br)cc(-c5cccc6ncccc56)c4)nc(-c4ccncc4)n3)cc2)cc1 |
| InChI | InChI=1S/C37H22BrN5/c38-31-20-29(32-3-1-5-34-33(32)4-2-16-41-34)19-30(21-31)36-22-35(42-37(43-36)28-14-17-40-18-15-28)27-12-10-26(11-13-27)25-8-6-24(23-39)7-9-25/h1-22H |
| InChIKey | KLSONQSVFDAEDZ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.52 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |