C12H23NO — CID 155709660
ethane;2-(4-ethyl-1,2-dihydropyridin-2-yl)propan-2-ol (PubChem CID 155709660) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;2-(4-ethyl-1,2-dihydropyridin-2-yl)propan-2-ol.
| Compound Name | ethane;2-(4-ethyl-1,2-dihydropyridin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 155709660 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;2-(4-ethyl-1,2-dihydropyridin-2-yl)propan-2-ol |
| SMILES | CC.CCC1=CC(C(C)(C)O)NC=C1 |
| InChI | InChI=1S/C10H17NO.C2H6/c1-4-8-5-6-11-9(7-8)10(2,3)12;1-2/h5-7,9,11-12H,4H2,1-3H3;1-2H3 |
| InChIKey | VSVHWUHWUILLAL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |