C15H23ClN2S — CID 155709819
N-[[4-(2-chloro-4-methylphenyl)piperidin-1-yl]methylsulfanyl]ethanamine (PubChem CID 155709819) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is N-[[4-(2-chloro-4-methylphenyl)piperidin-1-yl]methylsulfanyl]ethanamine.
| Compound Name | N-[[4-(2-chloro-4-methylphenyl)piperidin-1-yl]methylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 155709819 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[[4-(2-chloro-4-methylphenyl)piperidin-1-yl]methylsulfanyl]ethanamine |
| SMILES | CCNSCN1CCC(c2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C15H23ClN2S/c1-3-17-19-11-18-8-6-13(7-9-18)14-5-4-12(2)10-15(14)16/h4-5,10,13,17H,3,6-9,11H2,1-2H3 |
| InChIKey | GRWYFKULQRZXTG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|