About 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene
1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene (PubChem CID 155712803) has the molecular formula C20H29F
and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene.
Molecular Properties
| Compound Name | 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene |
| PubChem CID | 155712803 |
| Molecular Formula | C20H29F |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene |
| SMILES | CCC.CCc1cccc(F)c1C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H11F.C8H10.C3H8/c1-3-8-5-4-6-9(10)7(8)2;1-7-3-5-8(2)6-4-7;1-3-2/h4-6H,3H2,1-2H3;3-6H,1-2H3;3H2,1-2H3 |
| InChIKey | CRSMDVKNFGLUOY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene?
The IUPAC name of 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene (CID 155712803) is 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene.
What is the SMILES notation for 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene?
The canonical SMILES for 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene is CCC.CCc1cccc(F)c1C.Cc1ccc(C)cc1.
What is the InChIKey of 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene?
The InChIKey is CRSMDVKNFGLUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F.C8H10.C3H8/c1-3-8-5-4-6-9(10)7(8)2;1-7-3-5-8(2)6-4-7;1-3-2/h4-6H,3H2,1-2H3;3-6H,1-2H3;3H2,1-2H3.
What are the key properties of 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene?
1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene has a molecular weight of 288.45 g/mol, XLogP of 6.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-fluoro-2-methylbenzene;propane;1,4-xylene is sourced from PubChem (CID 155712803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).