C18H17FN2Si — CID 155716193
2-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane (PubChem CID 155716193) has the molecular formula C18H17FN2Si and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 155716193 |
| Molecular Formula | C18H17FN2Si |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1c(-c2ccc(F)cc2)nc2ccccn12 |
| InChI | InChI=1S/C18H17FN2Si/c1-22(2,3)13-11-16-18(14-7-9-15(19)10-8-14)20-17-6-4-5-12-21(16)17/h4-10,12H,1-3H3 |
| InChIKey | LPLARTBNWRYUKO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|