C18H18N2Si — CID 155716190
trimethyl-[2-(2-phenylimidazo[1,2-a]pyridin-3-yl)ethynyl]silane (PubChem CID 155716190) has the molecular formula C18H18N2Si and a molecular weight of 290.44 g/mol. Its IUPAC name is trimethyl-[2-(2-phenylimidazo[1,2-a]pyridin-3-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(2-phenylimidazo[1,2-a]pyridin-3-yl)ethynyl]silane |
|---|---|
| PubChem CID | 155716190 |
| Molecular Formula | C18H18N2Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | trimethyl-[2-(2-phenylimidazo[1,2-a]pyridin-3-yl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C18H18N2Si/c1-21(2,3)14-12-16-18(15-9-5-4-6-10-15)19-17-11-7-8-13-20(16)17/h4-11,13H,1-3H3 |
| InChIKey | SDEHNEITLRCENX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|