C17H10N4 — CID 5111894
2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]propanedinitrile (PubChem CID 5111894) has the molecular formula C17H10N4 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 5111894 |
| Molecular Formula | C17H10N4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C17H10N4/c18-11-13(12-19)10-15-17(14-6-2-1-3-7-14)20-16-8-4-5-9-21(15)16/h1-10H |
| InChIKey | YWVLGVJDXUBHDG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|