C18H14N4O2 — CID 177495034
(5E)-3-methyl-5-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 177495034) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (5E)-3-methyl-5-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-methyl-5-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 177495034 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5E)-3-methyl-5-[(2-phenylimidazo[1,2-a]pyridin-3-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N/C(=C/c2c(-c3ccccc3)nc3ccccn23)C1=O |
| InChI | InChI=1S/C18H14N4O2/c1-21-17(23)13(19-18(21)24)11-14-16(12-7-3-2-4-8-12)20-15-9-5-6-10-22(14)15/h2-11H,1H3,(H,19,24)/b13-11+ |
| InChIKey | AUYCIHMZBLDVQQ-ACCUITESSA-N |
| XLogP | 2.52 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|