C14H12N2 — CID 66561866
3-(dideuteriomethyl)-2-phenylimidazo[1,2-a]pyridine (PubChem CID 66561866) has the molecular formula C14H12N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(dideuteriomethyl)-2-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-(dideuteriomethyl)-2-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 66561866 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(dideuteriomethyl)-2-phenylimidazo[1,2-a]pyridine |
| SMILES | [2H]C([2H])c1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C14H12N2/c1-11-14(12-7-3-2-4-8-12)15-13-9-5-6-10-16(11)13/h2-10H,1H3/i1D2 |
| InChIKey | XWCGFQPHUYFTPC-DICFDUPASA-N |
| XLogP | 3.31 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |