C15H14N2O — CID 70813399
[4-(3-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanol (PubChem CID 70813399) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is [4-(3-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanol.
| Compound Name | [4-(3-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 70813399 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [4-(3-methylimidazo[1,2-a]pyridin-2-yl)phenyl]methanol |
| SMILES | Cc1c(-c2ccc(CO)cc2)nc2ccccn12 |
| InChI | InChI=1S/C15H14N2O/c1-11-15(13-7-5-12(10-18)6-8-13)16-14-4-2-3-9-17(11)14/h2-9,18H,10H2,1H3 |
| InChIKey | GYPZCCARVQONIN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |