C15H8BrN3O2S — CID 56797454
(Z)-3-[2-(5-bromothiophen-2-yl)imidazo[1,2-a]pyridin-3-yl]-2-cyanoprop-2-enoic acid (PubChem CID 56797454) has the molecular formula C15H8BrN3O2S and a molecular weight of 374.22 g/mol. Its IUPAC name is (Z)-3-[2-(5-bromothiophen-2-yl)imidazo[1,2-a]pyridin-3-yl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[2-(5-bromothiophen-2-yl)imidazo[1,2-a]pyridin-3-yl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 56797454 |
| Molecular Formula | C15H8BrN3O2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | (Z)-3-[2-(5-bromothiophen-2-yl)imidazo[1,2-a]pyridin-3-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C/c1c(-c2ccc(Br)s2)nc2ccccn12)C(=O)O |
| InChI | InChI=1S/C15H8BrN3O2S/c16-12-5-4-11(22-12)14-10(7-9(8-17)15(20)21)19-6-2-1-3-13(19)18-14/h1-7H,(H,20,21)/b9-7- |
| InChIKey | KBKNDMXKWVHFDY-CLFYSBASSA-N |
| XLogP | 3.82 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|