C18H27FN2O4S — CID 155717844
ethane;N-(4-fluoro-3-methylphenyl)-1-oxaldehydoyl-3-sulfanylpiperidine-4-carboxamide;methanol (PubChem CID 155717844) has the molecular formula C18H27FN2O4S and a molecular weight of 386.49 g/mol. Its IUPAC name is ethane;N-(4-fluoro-3-methylphenyl)-1-oxaldehydoyl-3-sulfanylpiperidine-4-carboxamide;methanol.
| Compound Name | ethane;N-(4-fluoro-3-methylphenyl)-1-oxaldehydoyl-3-sulfanylpiperidine-4-carboxamide;methanol |
|---|---|
| PubChem CID | 155717844 |
| Molecular Formula | C18H27FN2O4S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | ethane;N-(4-fluoro-3-methylphenyl)-1-oxaldehydoyl-3-sulfanylpiperidine-4-carboxamide;methanol |
| SMILES | CC.CO.Cc1cc(NC(=O)C2CCN(C(=O)C=O)CC2S)ccc1F |
| InChI | InChI=1S/C15H17FN2O3S.C2H6.CH4O/c1-9-6-10(2-3-12(9)16)17-15(21)11-4-5-18(7-13(11)22)14(20)8-19;2*1-2/h2-3,6,8,11,13,22H,4-5,7H2,1H3,(H,17,21);1-2H3;2H,1H3 |
| InChIKey | MDKOSDSRKLQIAA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|