C17H22FN3O4 — CID 122513394
N-(4-fluoro-3-methylphenyl)-1-[2-(1-hydroxypropan-2-ylamino)-2-oxoacetyl]pyrrolidine-3-carboxamide (PubChem CID 122513394) has the molecular formula C17H22FN3O4 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-[2-(1-hydroxypropan-2-ylamino)-2-oxoacetyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-[2-(1-hydroxypropan-2-ylamino)-2-oxoacetyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122513394 |
| Molecular Formula | C17H22FN3O4 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-[2-(1-hydroxypropan-2-ylamino)-2-oxoacetyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCN(C(=O)C(=O)NC(C)CO)C2)ccc1F |
| InChI | InChI=1S/C17H22FN3O4/c1-10-7-13(3-4-14(10)18)20-15(23)12-5-6-21(8-12)17(25)16(24)19-11(2)9-22/h3-4,7,11-12,22H,5-6,8-9H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | DWSXNNWIDCDNSC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|