C16H15ClF5N3O3 — CID 122513388
N-(3-chloro-4,5-difluorophenyl)-1-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]pyrrolidine-3-carboxamide (PubChem CID 122513388) has the molecular formula C16H15ClF5N3O3 and a molecular weight of 427.76 g/mol. Its IUPAC name is N-(3-chloro-4,5-difluorophenyl)-1-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]pyrrolidine-3-carboxamide.
| Compound Name | N-(3-chloro-4,5-difluorophenyl)-1-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122513388 |
| Molecular Formula | C16H15ClF5N3O3 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-(3-chloro-4,5-difluorophenyl)-1-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]pyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C(=O)N1CCC(C(=O)Nc2cc(F)c(F)c(Cl)c2)C1)C(F)(F)F |
| InChI | InChI=1S/C16H15ClF5N3O3/c1-7(16(20,21)22)23-14(27)15(28)25-3-2-8(6-25)13(26)24-9-4-10(17)12(19)11(18)5-9/h4-5,7-8H,2-3,6H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | AUYPVNJJPFGLAM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|