C15H15BrF2N2O4 — CID 131984225
ethyl 2-[(3S)-3-[(3-bromo-4,5-difluorophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoacetate (PubChem CID 131984225) has the molecular formula C15H15BrF2N2O4 and a molecular weight of 405.20 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[(3-bromo-4,5-difluorophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(3S)-3-[(3-bromo-4,5-difluorophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 131984225 |
| Molecular Formula | C15H15BrF2N2O4 |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | ethyl 2-[(3S)-3-[(3-bromo-4,5-difluorophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CC[C@H](C(=O)Nc2cc(F)c(F)c(Br)c2)C1 |
| InChI | InChI=1S/C15H15BrF2N2O4/c1-2-24-15(23)14(22)20-4-3-8(7-20)13(21)19-9-5-10(16)12(18)11(17)6-9/h5-6,8H,2-4,7H2,1H3,(H,19,21)/t8-/m0/s1 |
| InChIKey | BYKUIIRYQBSTEJ-QMMMGPOBSA-N |
| XLogP | 2.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|