C18H14F3N3O2S — CID 163269744
(3S)-1-(4H-thieno[3,2-b]pyrrole-5-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 163269744) has the molecular formula C18H14F3N3O2S and a molecular weight of 393.39 g/mol. Its IUPAC name is (3S)-1-(4H-thieno[3,2-b]pyrrole-5-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4H-thieno[3,2-b]pyrrole-5-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163269744 |
| Molecular Formula | C18H14F3N3O2S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (3S)-1-(4H-thieno[3,2-b]pyrrole-5-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)[C@H]1CCN(C(=O)c2cc3sccc3[nH]2)C1 |
| InChI | InChI=1S/C18H14F3N3O2S/c19-11-5-10(6-12(20)16(11)21)22-17(25)9-1-3-24(8-9)18(26)14-7-15-13(23-14)2-4-27-15/h2,4-7,9,23H,1,3,8H2,(H,22,25)/t9-/m0/s1 |
| InChIKey | PIGGVMKFUWDDTI-VIFPVBQESA-N |
| XLogP | 3.75 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|