C24H20F3N5O2 — CID 163269658
(3S)-1-[5-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 163269658) has the molecular formula C24H20F3N5O2 and a molecular weight of 467.45 g/mol. Its IUPAC name is (3S)-1-[5-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[5-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163269658 |
| Molecular Formula | C24H20F3N5O2 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (3S)-1-[5-(1-methylpyrrolo[3,2-b]pyridin-3-yl)-1H-pyrrole-2-carbonyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | Cn1cc(-c2ccc(C(=O)N3CC[C@H](C(=O)Nc4cc(F)c(F)c(F)c4)C3)[nH]2)c2ncccc21 |
| InChI | InChI=1S/C24H20F3N5O2/c1-31-12-15(22-20(31)3-2-7-28-22)18-4-5-19(30-18)24(34)32-8-6-13(11-32)23(33)29-14-9-16(25)21(27)17(26)10-14/h2-5,7,9-10,12-13,30H,6,8,11H2,1H3,(H,29,33)/t13-/m0/s1 |
| InChIKey | YHXQKTOINYGMON-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|