C20H16F3N5O2 — CID 163269580
(3S)-1-(5-pyrimidin-5-yl-1H-pyrrole-2-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 163269580) has the molecular formula C20H16F3N5O2 and a molecular weight of 415.38 g/mol. Its IUPAC name is (3S)-1-(5-pyrimidin-5-yl-1H-pyrrole-2-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(5-pyrimidin-5-yl-1H-pyrrole-2-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163269580 |
| Molecular Formula | C20H16F3N5O2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (3S)-1-(5-pyrimidin-5-yl-1H-pyrrole-2-carbonyl)-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)[C@H]1CCN(C(=O)c2ccc(-c3cncnc3)[nH]2)C1 |
| InChI | InChI=1S/C20H16F3N5O2/c21-14-5-13(6-15(22)18(14)23)26-19(29)11-3-4-28(9-11)20(30)17-2-1-16(27-17)12-7-24-10-25-8-12/h1-2,5-8,10-11,27H,3-4,9H2,(H,26,29)/t11-/m0/s1 |
| InChIKey | KYRVCMGSUPFWDV-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|