C20H20F5N5O3S — CID 161109072
(3S)-1-[3-[3,3-difluoro-1-(2H-triazol-4-yl)cyclobutyl]-2-oxopropanoyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane (PubChem CID 161109072) has the molecular formula C20H20F5N5O3S and a molecular weight of 505.47 g/mol. Its IUPAC name is (3S)-1-[3-[3,3-difluoro-1-(2H-triazol-4-yl)cyclobutyl]-2-oxopropanoyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane.
| Compound Name | (3S)-1-[3-[3,3-difluoro-1-(2H-triazol-4-yl)cyclobutyl]-2-oxopropanoyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 161109072 |
| Molecular Formula | C20H20F5N5O3S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (3S)-1-[3-[3,3-difluoro-1-(2H-triazol-4-yl)cyclobutyl]-2-oxopropanoyl]-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide;sulfane |
| SMILES | O=C(CC1(c2cn[nH]n2)CC(F)(F)C1)C(=O)N1CC[C@H](C(=O)Nc2cc(F)c(F)c(F)c2)C1.S |
| InChI | InChI=1S/C20H18F5N5O3.H2S/c21-12-3-11(4-13(22)16(12)23)27-17(32)10-1-2-30(7-10)18(33)14(31)5-19(8-20(24,25)9-19)15-6-26-29-28-15;/h3-4,6,10H,1-2,5,7-9H2,(H,27,32)(H,26,28,29);1H2/t10-;/m0./s1 |
| InChIKey | UJLLWJVHCQNDAG-PPHPATTJSA-N |
| XLogP | 2.45 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|