C15H18FN3O2U — CID 155718607
[(3-fluorophenyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propylideneamino]methylidene]azanide;uranium(2+) (PubChem CID 155718607) has the molecular formula C15H18FN3O2U and a molecular weight of 529.36 g/mol. Its IUPAC name is [(3-fluorophenyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propylideneamino]methylidene]azanide;uranium(2+).
| Compound Name | [(3-fluorophenyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propylideneamino]methylidene]azanide;uranium(2+) |
|---|---|
| PubChem CID | 155718607 |
| Molecular Formula | C15H18FN3O2U |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | [(3-fluorophenyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propylideneamino]methylidene]azanide;uranium(2+) |
| SMILES | CC(/[C-]=N/C(=[N-])c1cccc(F)c1)NC(=O)OC(C)(C)C.[U+2] |
| InChI | InChI=1S/C15H18FN3O2.U/c1-10(19-14(20)21-15(2,3)4)9-18-13(17)11-6-5-7-12(16)8-11;/h5-8,10H,1-4H3,(H,19,20);/q-2;+2 |
| InChIKey | CTKBFYHEVRJAIS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|